Orvepitant
Modify Date: 2025-08-26 22:40:27
Orvepitant structure
|
Common Name | Orvepitant | ||
|---|---|---|---|---|
| CAS Number | 579475-18-6 | Molecular Weight | 628.62400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H35F7N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of OrvepitantOrvepitant (GW823296) is a potent and selective, brain penetrant NK1 receptor antagonist with pKi of 10.2. |
| Name | (2R,4S)-4-[(8aS)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-N-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-(4-fluoro-2-methylphenyl)-N-methylpiperidine-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C31H35F7N4O2 |
|---|---|
| Molecular Weight | 628.62400 |
| Exact Mass | 628.26500 |
| PSA | 47.10000 |
| LogP | 6.61050 |
| InChIKey | XWNBGDJPEXZSQM-VZOBGQTKSA-N |
| SMILES | Cc1cc(F)ccc1C1CC(N2CCN3C(=O)CCC3C2)CCN1C(=O)N(C)C(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:579475-24-4| UNII-IIU6V0W3JD |
| Orvepitant |