(3,4-dibenzoyloxy-5-carbamothioyl-oxolan-2-yl)methyl benzoate structure
|
Common Name | (3,4-dibenzoyloxy-5-carbamothioyl-oxolan-2-yl)methyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 57944-10-2 | Molecular Weight | 505.53900 | |
| Density | 1.39g/cm3 | Boiling Point | 661.7ºC at 760 mmHg | |
| Molecular Formula | C27H23NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354ºC | |
| Name | (3,4-dibenzoyloxy-5-carbamothioyloxolan-2-yl)methyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 661.7ºC at 760 mmHg |
| Molecular Formula | C27H23NO7S |
| Molecular Weight | 505.53900 |
| Flash Point | 354ºC |
| Exact Mass | 505.12000 |
| PSA | 146.24000 |
| LogP | 4.04840 |
| Index of Refraction | 1.658 |
| InChIKey | CKTMVNDDGTXBJC-UHFFFAOYSA-N |
| SMILES | NC(=S)C1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
|
~97%
(3,4-dibenzoylo... CAS#:57944-10-2 |
| Literature: Ramasamy, Kanda S.; Averett, Devron Nucleosides and Nucleotides, 1999 , vol. 18, # 11-12 p. 2425 - 2431 |
|
~97%
(3,4-dibenzoylo... CAS#:57944-10-2 |
| Literature: ICN Pharmaceuticals, Inc. Patent: US5907036 A1, 1999 ; |
|
~%
(3,4-dibenzoylo... CAS#:57944-10-2 |
| Literature: Ramasamy, Kanda S.; Averett, Devron Nucleosides and Nucleotides, 1999 , vol. 18, # 11-12 p. 2425 - 2431 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| 2,5-anhydro-3,4,6-tri-O-benzoyl-D-allonthioamide |
| tri-O-benzoyl-D-2,5-anhydro-allonothioic acid amide |