N-ethyl-4-(4-nitrophenyl)sulfanylaniline
Modify Date: 2025-09-21 10:09:15
N-ethyl-4-(4-nitrophenyl)sulfanylaniline structure
|
Common Name | N-ethyl-4-(4-nitrophenyl)sulfanylaniline | ||
|---|---|---|---|---|
| CAS Number | 5786-51-6 | Molecular Weight | 274.33800 | |
| Density | 1.26g/cm3 | Boiling Point | 476.5ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242ºC | |
| Name | N-ethyl-4-(4-nitrophenyl)sulfanylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 476.5ºC at 760 mmHg |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.33800 |
| Flash Point | 242ºC |
| Exact Mass | 274.07800 |
| PSA | 83.15000 |
| LogP | 4.77400 |
| Index of Refraction | 1.645 |
| InChIKey | RPGPTHLUEOMMRN-UHFFFAOYSA-N |
| SMILES | CCNc1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
N-ethyl-4-(4-ni... CAS#:5786-51-6 |
| Literature: Khosla et al. Journal of Scientific and Industrial Research, 1954 , vol. 13B, p. 256,259 |
![toluene-4-sulfonic acid-[N-ethyl-4-(4-nitro-phenylsulfanyl)-anilide] structure](https://image.chemsrc.com/caspic/404/859491-44-4.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Nitro-p'-ethylaminodiphenylsulfide |
| p-Nitro-p'-ethylaminodiphenylsulphide |