4-[phenyl(propoxy)phosphinothioyl]oxybenzonitrile
Modify Date: 2025-08-25 18:53:39
![4-[phenyl(propoxy)phosphinothioyl]oxybenzonitrile Structure](https://image.chemsrc.com/caspic/170/57856-28-7.png)
4-[phenyl(propoxy)phosphinothioyl]oxybenzonitrile structure
|
Common Name | 4-[phenyl(propoxy)phosphinothioyl]oxybenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 57856-28-7 | Molecular Weight | 317.34300 | |
| Density | 1.24g/cm3 | Boiling Point | 435.9ºC at 760 mmHg | |
| Molecular Formula | C16H16NO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.4ºC | |
| Name | 4-[phenyl(propoxy)phosphinothioyl]oxybenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 435.9ºC at 760 mmHg |
| Molecular Formula | C16H16NO2PS |
| Molecular Weight | 317.34300 |
| Flash Point | 217.4ºC |
| Exact Mass | 317.06400 |
| PSA | 84.15000 |
| LogP | 4.64928 |
| Index of Refraction | 1.597 |
| InChIKey | HORQTRMCYAKYIM-UHFFFAOYSA-N |
| SMILES | CCCOP(=S)(Oc1ccc(C#N)cc1)c1ccccc1 |
| HS Code | 2930909090 |
|---|
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Phosphonothioic acid,phenyl-,O-propyl ester,O-ester with p-hydroxybenzonitrile |
| Phenylphosphonothioic acid O-propyl ester O-ester with p-hydroxybenzonitrile |
| O-Propyl-O-<4-cyan-phenyl>-phenyl-thiophosphorsaeure |