3,4,5,6-Tetrahydro-6-(3,5-xylyloxymethyl)-2H-1,3-oxazine-2-thione structure
|
Common Name | 3,4,5,6-Tetrahydro-6-(3,5-xylyloxymethyl)-2H-1,3-oxazine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 57841-38-0 | Molecular Weight | 251.34500 | |
| Density | 1.18g/cm3 | Boiling Point | 365.8ºC at 760 mmHg | |
| Molecular Formula | C13H17NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175ºC | |
| Name | 6-[(3,5-dimethylphenoxy)methyl]-1,3-oxazinane-2-thione |
|---|
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 365.8ºC at 760 mmHg |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.34500 |
| Flash Point | 175ºC |
| Exact Mass | 251.09800 |
| PSA | 69.62000 |
| LogP | 2.19250 |
| Index of Refraction | 1.589 |
| InChIKey | FJYZGKFLWKKSIX-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(OCC2CCNC(=S)O2)c1 |
|
~%
3,4,5,6-Tetrahy... CAS#:57841-38-0 |
| Literature: Fauran; Douzon European Journal of Medicinal Chemistry, 1976 , vol. 11, # 1 p. 73 - 74 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |