3-(4-tert-butylphenyl)-N-(4-fluorophenyl)prop-2-enamide
Modify Date: 2025-09-18 12:01:23
3-(4-tert-butylphenyl)-N-(4-fluorophenyl)prop-2-enamide structure
|
Common Name | 3-(4-tert-butylphenyl)-N-(4-fluorophenyl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 5780-97-2 | Molecular Weight | 297.36700 | |
| Density | 1.133g/cm3 | Boiling Point | 452.2ºC at 760mmHg | |
| Molecular Formula | C19H20FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.3ºC | |
| Name | 3-(4-tert-butylphenyl)-N-(4-fluorophenyl)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 452.2ºC at 760mmHg |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.36700 |
| Flash Point | 227.3ºC |
| Exact Mass | 297.15300 |
| PSA | 29.10000 |
| LogP | 4.84810 |
| Index of Refraction | 1.6 |
| InChIKey | BCSPMKZEIWLDBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C=CC(=O)Nc2ccc(F)cc2)cc1 |
|
~%
3-(4-tert-butyl... CAS#:5780-97-2 |
| Literature: Weidauer, Maik; Irran, Elisabeth; Someya, Chika I.; Haberberger, Michael; Enthaler, Stephan Journal of Organometallic Chemistry, 2013 , vol. 729, p. 53 - 59 |
| ethyl-d5-magnesium bromide |
| d5-ethylmagnesium bromide |