4-chloro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine structure
|
Common Name | 4-chloro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine | ||
|---|---|---|---|---|
| CAS Number | 5778-90-5 | Molecular Weight | 246.73500 | |
| Density | 1.261g/cm3 | Boiling Point | 449.6ºC at 760 mmHg | |
| Molecular Formula | C14H15ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.7ºC | |
| Name | 4-chloro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 449.6ºC at 760 mmHg |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.73500 |
| Flash Point | 225.7ºC |
| Exact Mass | 246.09200 |
| PSA | 38.91000 |
| LogP | 4.32050 |
| Index of Refraction | 1.666 |
| InChIKey | KUXRCNIQUKGCGU-UHFFFAOYSA-N |
| SMILES | Nc1c2c(nc3c(Cl)cccc13)CCCCC2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| mas 805 |