Ethyl 5-acetyl-2-amino-4-methylthiophene-3-carboxylate structure
|
Common Name | Ethyl 5-acetyl-2-amino-4-methylthiophene-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 57773-41-8 | Molecular Weight | 227.28000 | |
| Density | 1.239g/cm3 | Boiling Point | 405.2ºC at 760mmHg | |
| Molecular Formula | C10H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.9ºC | |
| Name | Ethyl 5-acetyl-2-amino-4-methylthiophene-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 405.2ºC at 760mmHg |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28000 |
| Flash Point | 198.9ºC |
| Exact Mass | 227.06200 |
| PSA | 97.63000 |
| LogP | 2.59920 |
| Index of Refraction | 1.569 |
| InChIKey | BYBXJRFAEPGDLK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(N)sc(C(C)=O)c1C |
| HS Code | 2934999090 |
|---|
|
~88%
Ethyl 5-acetyl-... CAS#:57773-41-8 |
| Literature: Hafez, Hend N.; El-Gazzar, Abdel-Rahman B.A.; Nawwar, Galal A.M. European Journal of Medicinal Chemistry, 2010 , vol. 45, # 4 p. 1485 - 1493 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 5-acetyl-2-amino-4-methyl-3-thiophenecarboxylate |
| 2-Amino-3-aethoxycarbonyl-4-methyl-5-acetyl-thiophen |
| 5-Acetyl-2-amino-4-methyl-thiophen-3-carbonsaeureethylester |
| 5-Acetyl-2-amino-4-methyl-thiophene-3-carboxylic acid ethyl ester |