Isobenzofuran,5,6-dimethyl-1,3-bis(4-methylphenyl)- structure
|
Common Name | Isobenzofuran,5,6-dimethyl-1,3-bis(4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 57703-44-3 | Molecular Weight | 326.43100 | |
| Density | 1.08g/cm3 | Boiling Point | 489ºC at 760mmHg | |
| Molecular Formula | C24H22O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.5ºC | |
| Name | 5,6-dimethyl-1,3-bis(4-methylphenyl)-2-benzofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 489ºC at 760mmHg |
| Molecular Formula | C24H22O |
| Molecular Weight | 326.43100 |
| Flash Point | 256.5ºC |
| Exact Mass | 326.16700 |
| PSA | 13.14000 |
| LogP | 7.00040 |
| Index of Refraction | 1.611 |
| InChIKey | MGTRFHDQEDLPJY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2oc(-c3ccc(C)cc3)c3cc(C)c(C)cc23)cc1 |
|
~%
Isobenzofuran,5... CAS#:57703-44-3 |
| Literature: Adams; Wearn Journal of the American Chemical Society, 1940 , vol. 62, p. 1233,1235 |
|
~%
Isobenzofuran,5... CAS#:57703-44-3 |
| Literature: Adams; Wearn Journal of the American Chemical Society, 1940 , vol. 62, p. 1233,1235 |
|
~%
Isobenzofuran,5... CAS#:57703-44-3 |
| Literature: Adams; Wearn Journal of the American Chemical Society, 1940 , vol. 62, p. 1233,1235 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5,6-dimethyl-1,3-di-p-tolyl-isobenzofuran |
| Isobenzofuran,5,6-dimethyl-1,3-bis(4-methylphenyl) |