Bicyclo[4.2.0]octane-7-carbonitrile,7-(1,1-dimethylethyl)-8-oxo- structure
|
Common Name | Bicyclo[4.2.0]octane-7-carbonitrile,7-(1,1-dimethylethyl)-8-oxo- | ||
|---|---|---|---|---|
| CAS Number | 57681-20-6 | Molecular Weight | 205.29600 | |
| Density | 1.03g/cm3 | Boiling Point | 329.5ºC at 760 mmHg | |
| Molecular Formula | C13H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.1ºC | |
| Name | 7-tert-butyl-8-oxobicyclo[4.2.0]octane-7-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 329.5ºC at 760 mmHg |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.29600 |
| Flash Point | 153.1ºC |
| Exact Mass | 205.14700 |
| PSA | 40.86000 |
| LogP | 2.93158 |
| Index of Refraction | 1.497 |
| InChIKey | HKXYKDXRNHMZDA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1(C#N)C(=O)C2CCCCC21 |
|
~%
Bicyclo[4.2.0]o... CAS#:57681-20-6 |
| Literature: Weyler,W. et al. Journal of the American Chemical Society, 1975 , vol. 97, p. 6187 - 6192 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-tert-butyl-7-oxobicyclo[4.2.0]octane-8-carbonitrile |
| 7-Cyano-7-t-butyl-bicyclo[4.2.0]octan-8-on |