N-diethoxyphosphoryl-1,1-diphenyl-methanamine structure
|
Common Name | N-diethoxyphosphoryl-1,1-diphenyl-methanamine | ||
|---|---|---|---|---|
| CAS Number | 57673-92-4 | Molecular Weight | 319.33500 | |
| Density | 1.135g/cm3 | Boiling Point | 420.9ºC at 760 mmHg | |
| Molecular Formula | C17H22NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.3ºC | |
| Name | N-diethoxyphosphoryl-1,1-diphenylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 420.9ºC at 760 mmHg |
| Molecular Formula | C17H22NO3P |
| Molecular Weight | 319.33500 |
| Flash Point | 208.3ºC |
| Exact Mass | 319.13400 |
| PSA | 57.37000 |
| LogP | 4.93760 |
| Index of Refraction | 1.538 |
| InChIKey | KZDTXHXNQKAKNI-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(NC(c1ccccc1)c1ccccc1)OCC |
|
~85%
N-diethoxyphosp... CAS#:57673-92-4 |
| Literature: Oi, Shuichi; Moro, Mitsutoshi; Fukuhara, Hiroe; Kawanishi, Takanori; Inoue, Yoshio Tetrahedron Letters, 1999 , vol. 40, # 52 p. 9259 - 9262 |
|
~%
N-diethoxyphosp... CAS#:57673-92-4 |
| Literature: Zawadzki, Stefan Phosphorus and Sulfur and the Related Elements, 1988 , vol. 40, p. 263 - 268 |
| N-(diethoxyphosphoryl)(diphenylmethyl)amine |
| diethyl(diphenylmethyl)phosphoramidate |
| (diphenylmethyl)-phosphoramidic acid,diethyl ester |