ethyl 1-benzyl-4-(phenylcarbamoylamino)piperidine-4-carboxylate
Modify Date: 2025-09-18 17:36:28
ethyl 1-benzyl-4-(phenylcarbamoylamino)piperidine-4-carboxylate structure
|
Common Name | ethyl 1-benzyl-4-(phenylcarbamoylamino)piperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 57611-97-9 | Molecular Weight | 381.46800 | |
| Density | 1.2g/cm3 | Boiling Point | 493.8ºC at 760 mmHg | |
| Molecular Formula | C22H27N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.5ºC | |
| Name | ethyl 1-benzyl-4-(phenylcarbamoylamino)piperidine-4-carboxylate |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 493.8ºC at 760 mmHg |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.46800 |
| Flash Point | 252.5ºC |
| Exact Mass | 381.20500 |
| PSA | 74.16000 |
| LogP | 3.74840 |
| Index of Refraction | 1.604 |
| InChIKey | YCHORZJCCDRYDJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(NC(=O)Nc2ccccc2)CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |