7,8-dimethoxy-4,5-dihydrobenzo[g][1,2]benzoxazole structure
|
Common Name | 7,8-dimethoxy-4,5-dihydrobenzo[g][1,2]benzoxazole | ||
|---|---|---|---|---|
| CAS Number | 57595-83-2 | Molecular Weight | 231.24700 | |
| Density | 1.216g/cm3 | Boiling Point | 394.5ºC at 760 mmHg | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.4ºC | |
| Name | 7,8-dimethoxy-4,5-dihydrobenzo[g][1,2]benzoxazole |
|---|
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 394.5ºC at 760 mmHg |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.24700 |
| Flash Point | 192.4ºC |
| Exact Mass | 231.09000 |
| PSA | 44.49000 |
| LogP | 2.45740 |
| Index of Refraction | 1.567 |
| InChIKey | XLJYSINRWKQDGR-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)-c1oncc1CC2 |
|
~%
7,8-dimethoxy-4... CAS#:57595-83-2 |
| Literature: Hashem,M.M. et al. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 229 - 239 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |