N-[4-(2-bromoethylsulfonyl)phenyl]acetamide
Modify Date: 2025-08-25 19:10:57
![N-[4-(2-bromoethylsulfonyl)phenyl]acetamide Structure](https://image.chemsrc.com/caspic/099/5755-74-8.png)
N-[4-(2-bromoethylsulfonyl)phenyl]acetamide structure
|
Common Name | N-[4-(2-bromoethylsulfonyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5755-74-8 | Molecular Weight | 306.17600 | |
| Density | 1.578g/cm3 | Boiling Point | 529.1ºC at 760 mmHg | |
| Molecular Formula | C10H12BrNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.8ºC | |
| Name | N-[4-(2-bromoethylsulfonyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.578g/cm3 |
|---|---|
| Boiling Point | 529.1ºC at 760 mmHg |
| Molecular Formula | C10H12BrNO3S |
| Molecular Weight | 306.17600 |
| Flash Point | 273.8ºC |
| Exact Mass | 304.97200 |
| PSA | 71.62000 |
| LogP | 2.96740 |
| Index of Refraction | 1.591 |
| InChIKey | ICWKHHHNIOXUTD-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)CCBr)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-[4-(2-bromoet... CAS#:5755-74-8 |
| Literature: Salerni,O.L. et al. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 645 - 648 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(4-Acetamino-phenylsulfonyl)-aethylbromid |
| n-{4-[(2-bromoethyl)sulfonyl]phenyl}acetamide |