1-(1,2-DIOXOPROPYL)-S-PROLINE
Modify Date: 2025-08-21 20:28:30
1-(1,2-DIOXOPROPYL)-S-PROLINE structure
|
Common Name | 1-(1,2-DIOXOPROPYL)-S-PROLINE | ||
|---|---|---|---|---|
| CAS Number | 57527-78-3 | Molecular Weight | 333.42500 | |
| Density | 1.341g/cm3 | Boiling Point | 483.2ºC at 760 mmHg | |
| Molecular Formula | C16H15NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246ºC | |
| Name | 1-(1,3-benzothiazol-2-yl)ethyl 4-methylbenzenesulfonate |
|---|
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 483.2ºC at 760 mmHg |
| Molecular Formula | C16H15NO3S2 |
| Molecular Weight | 333.42500 |
| Flash Point | 246ºC |
| Exact Mass | 333.04900 |
| PSA | 92.88000 |
| LogP | 5.15200 |
| Index of Refraction | 1.638 |
| InChIKey | LUFVVEPVDDTGQU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)c2nc3ccccc3s2)cc1 |
| HS Code | 2934200090 |
|---|
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |