4-benzylidene-2-(2-bromophenyl)-1,3-oxazol-5-one structure
|
Common Name | 4-benzylidene-2-(2-bromophenyl)-1,3-oxazol-5-one | ||
|---|---|---|---|---|
| CAS Number | 57515-98-7 | Molecular Weight | 328.16000 | |
| Density | 1.45g/cm3 | Boiling Point | 434.1ºC at 760 mmHg | |
| Molecular Formula | C16H10BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.3ºC | |
| Name | (4E)-4-benzylidene-2-(2-bromophenyl)-1,3-oxazol-5-one |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 434.1ºC at 760 mmHg |
| Molecular Formula | C16H10BrNO2 |
| Molecular Weight | 328.16000 |
| Flash Point | 216.3ºC |
| Exact Mass | 326.98900 |
| PSA | 38.66000 |
| LogP | 3.22920 |
| Index of Refraction | 1.641 |
| InChIKey | LJDTVODLOJLOOW-GXDHUFHOSA-N |
| SMILES | O=C1OC(c2ccccc2Br)=NC1=Cc1ccccc1 |
|
~%
4-benzylidene-2... CAS#:57515-98-7 |
| Literature: Grimshaw, James; Hamilton, Robert; Trocha-Grimshaw, Jadwiga Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , p. 229 - 234 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |