4,4,5,5,6,6,6-heptafluoro-1-(3-methylthiophen-2-yl)hexane-1,3-dione
Modify Date: 2025-09-29 13:32:14
4,4,5,5,6,6,6-heptafluoro-1-(3-methylthiophen-2-yl)hexane-1,3-dione structure
|
Common Name | 4,4,5,5,6,6,6-heptafluoro-1-(3-methylthiophen-2-yl)hexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 575-93-9 | Molecular Weight | 336.22600 | |
| Density | 1.473g/cm3 | Boiling Point | 292ºC at 760 mmHg | |
| Molecular Formula | C11H7F7O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.4ºC | |
| Name | 4,4,5,5,6,6,6-heptafluoro-1-(3-methylthiophen-2-yl)hexane-1,3-dione |
|---|
| Density | 1.473g/cm3 |
|---|---|
| Boiling Point | 292ºC at 760 mmHg |
| Molecular Formula | C11H7F7O2S |
| Molecular Weight | 336.22600 |
| Flash Point | 130.4ºC |
| Exact Mass | 336.00500 |
| PSA | 62.38000 |
| LogP | 4.03130 |
| Index of Refraction | 1.431 |
| InChIKey | JVPMZBDOUZPNPW-UHFFFAOYSA-N |
| SMILES | Cc1ccsc1C(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
4,4,5,5,6,6,6-h... CAS#:575-93-9 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1951 , vol. 73, p. 4625 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |