2-(2,5-dimethyl-3-nitro-phenyl)acetonitrile structure
|
Common Name | 2-(2,5-dimethyl-3-nitro-phenyl)acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 57411-95-7 | Molecular Weight | 190.19900 | |
| Density | 1.188g/cm3 | Boiling Point | 356.2ºC at 760 mmHg | |
| Molecular Formula | C10H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.2ºC | |
| Name | 2-(2,5-dimethyl-3-nitrophenyl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 356.2ºC at 760 mmHg |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.19900 |
| Flash Point | 169.2ºC |
| Exact Mass | 190.07400 |
| PSA | 69.61000 |
| LogP | 2.80088 |
| Index of Refraction | 1.562 |
| InChIKey | ONEKRZQNJHXOGV-UHFFFAOYSA-N |
| SMILES | Cc1cc(CC#N)c(C)c([N+](=O)[O-])c1 |
|
~%
2-(2,5-dimethyl... CAS#:57411-95-7 |
| Literature: Winchester; Popp Journal of Heterocyclic Chemistry, 1975 , vol. 12, # 3 p. 547 - 549 |
|
~%
2-(2,5-dimethyl... CAS#:57411-95-7 |
| Literature: Winchester; Popp Journal of Heterocyclic Chemistry, 1975 , vol. 12, # 3 p. 547 - 549 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Cyanomethyl-2,5-dimethylnitrobenzol |