4-chloro-2-(3,4-dimethylanilino)benzoic acid structure
|
Common Name | 4-chloro-2-(3,4-dimethylanilino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 57397-98-5 | Molecular Weight | 275.73000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-2-(3,4-dimethylanilino)benzoic acid |
|---|
| Molecular Formula | C15H14ClNO2 |
|---|---|
| Molecular Weight | 275.73000 |
| Exact Mass | 275.07100 |
| PSA | 49.33000 |
| LogP | 4.47160 |
| InChIKey | LZWBQYBITWSPKU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2cc(Cl)ccc2C(=O)O)cc1C |
|
~%
4-chloro-2-(3,4... CAS#:57397-98-5 |
| Literature: Moffett,R.B.; Aspergren,B.D. Journal of the American Chemical Society, 1960 , vol. 82, p. 1600 - 1607 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |