bis(2,2,2-trichloroethyl) hexanedioate
Modify Date: 2025-08-25 18:46:40
bis(2,2,2-trichloroethyl) hexanedioate structure
|
Common Name | bis(2,2,2-trichloroethyl) hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 57392-52-6 | Molecular Weight | 408.91800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12Cl6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(2,2,2-trichloroethyl) hexanedioate |
|---|
| Molecular Formula | C10H12Cl6O4 |
|---|---|
| Molecular Weight | 408.91800 |
| Exact Mass | 405.88700 |
| PSA | 52.60000 |
| LogP | 4.37360 |
| InChIKey | ORLGXGVFGFWARG-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC(=O)OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
|
~86%
bis(2,2,2-trich... CAS#:57392-52-6 |
| Literature: Chaudhary, Apurva K.; Beckman, Eric J.; Russell, Alan J. Journal of the American Chemical Society, 1995 , vol. 117, # 13 p. 3728 - 3733 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |