3-iodobiphenyl-4-carboxylic acid
Modify Date: 2025-08-27 11:05:33
3-iodobiphenyl-4-carboxylic acid structure
|
Common Name | 3-iodobiphenyl-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 5737-84-8 | Molecular Weight | 324.11400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-iodo-4-phenylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9IO2 |
|---|---|
| Molecular Weight | 324.11400 |
| Exact Mass | 323.96500 |
| PSA | 37.30000 |
| LogP | 3.65640 |
| InChIKey | BIXNTXRUYTWXGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)C(=O)O)I |
|
~%
3-iodobiphenyl-... CAS#:5737-84-8 |
| Literature: Byron,D.J. et al. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 840 - 845 |
|
~%
3-iodobiphenyl-... CAS#:5737-84-8 |
| Literature: Byron,D.J. et al. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 840 - 845 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3'-Jodbiphenyl-4-carbonsaeure |
| 3'-Iod-biphenyl-4-carbonsaeure |
| 3-iodobiphenyl-4-carboxylic acid |
| QC-8185 |