2-[(2,4-dimethylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Modify Date: 2025-06-18 18:23:52
![2-[(2,4-dimethylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide Structure](https://image.chemsrc.com/caspic/220/5728-37-0.png)
2-[(2,4-dimethylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide structure
|
Common Name | 2-[(2,4-dimethylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5728-37-0 | Molecular Weight | 387.51900 | |
| Density | 1.354g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H21N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2,4-dimethylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.354g/cm3 |
|---|---|
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.51900 |
| Exact Mass | 387.10800 |
| PSA | 148.04000 |
| LogP | 4.81750 |
| Index of Refraction | 1.695 |
| InChIKey | CXVIBHLRCPSALW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2sc3c(c2C(N)=O)CCCC3)c(C)c1 |
|
~%
2-[(2,4-dimethy... CAS#:5728-37-0 |
| Literature: Byron,D.J. et al. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 840 - 845 |
| 2-Chlor-4-cyan-biphenyl |