2-amino-N,N,N,N-tetraethyl-4,6-dimethyl-3-oxo-phenoxazine-1,9-dicarboxamide structure
|
Common Name | 2-amino-N,N,N,N-tetraethyl-4,6-dimethyl-3-oxo-phenoxazine-1,9-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 57270-56-1 | Molecular Weight | 438.51900 | |
| Density | 1.25g/cm3 | Boiling Point | 641.5ºC at 760 mmHg | |
| Molecular Formula | C24H30N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.8ºC | |
| Name | 2-amino-1-N,1-N,9-N,9-N-tetraethyl-4,6-dimethyl-3-oxophenoxazine-1,9-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 641.5ºC at 760 mmHg |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.51900 |
| Flash Point | 341.8ºC |
| Exact Mass | 438.22700 |
| PSA | 109.74000 |
| LogP | 4.03700 |
| Index of Refraction | 1.61 |
| InChIKey | NAYXTGWSJYBNPY-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)c1c2nc3c(C(=O)N(CC)CC)ccc(C)c3oc-2c(C)c(=O)c1N |
|
~55%
2-amino-N,N,N,N... CAS#:57270-56-1 |
| Literature: Sehgal, Raj K. Liebigs Annalen der Chemie, 1990 , # 12 p. 1269 - 1271 |
|
~%
2-amino-N,N,N,N... CAS#:57270-56-1 |
| Literature: Sengupta; Tinter; Lazarus; Brown; Modest Journal of Medicinal Chemistry, 1975 , vol. 18, # 12 p. 1175 - 1180 |
| 2-Amino-N,N,N',N'-tetraethyl-4,6-dimethyl-3-oxo-3H-phenoxazine-1,9-dicarboxamide |
| 2-amino-4,6-dimethyl-3-oxo-3H-phenoxazine-1,9-dicarboxylic acid bis-diethylamide |