propyl 7-(4-chlorophenyl)-2-methyl-5-oxo-4-(4-propoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate
Modify Date: 2025-10-17 12:32:10
propyl 7-(4-chlorophenyl)-2-methyl-5-oxo-4-(4-propoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate structure
|
Common Name | propyl 7-(4-chlorophenyl)-2-methyl-5-oxo-4-(4-propoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5724-93-6 | Molecular Weight | 494.02200 | |
| Density | 1.23g/cm3 | Boiling Point | 627.8ºC at 760 mmHg | |
| Molecular Formula | C29H32ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.5ºC | |
| Name | propyl 7-(4-chlorophenyl)-2-methyl-5-oxo-4-(4-propoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 627.8ºC at 760 mmHg |
| Molecular Formula | C29H32ClNO4 |
| Molecular Weight | 494.02200 |
| Flash Point | 333.5ºC |
| Exact Mass | 493.20200 |
| PSA | 64.63000 |
| LogP | 6.77240 |
| Index of Refraction | 1.601 |
| InChIKey | YFCOMOLRICEVBB-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=C(C)NC2=C(C(=O)CC(c3ccc(Cl)cc3)C2)C1c1ccc(OCCC)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Amino-3-<2,4-dimethylphenoxy>-1-benzolsulfonyl-1,2,4-triazol |