1,1,1-trichloro-5-trimethylsilylpent-3-yn-2-ol
Modify Date: 2025-09-11 14:21:07
1,1,1-trichloro-5-trimethylsilylpent-3-yn-2-ol structure
|
Common Name | 1,1,1-trichloro-5-trimethylsilylpent-3-yn-2-ol | ||
|---|---|---|---|---|
| CAS Number | 57212-21-2 | Molecular Weight | 259.63300 | |
| Density | 1.226g/cm3 | Boiling Point | 256.2ºC at 760 mmHg | |
| Molecular Formula | C8H13Cl3OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.7ºC | |
| Name | 1,1,1-trichloro-5-trimethylsilylpent-3-yn-2-ol |
|---|
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 256.2ºC at 760 mmHg |
| Molecular Formula | C8H13Cl3OSi |
| Molecular Weight | 259.63300 |
| Flash Point | 108.7ºC |
| Exact Mass | 257.98000 |
| PSA | 20.23000 |
| LogP | 3.05910 |
| Index of Refraction | 1.495 |
| InChIKey | XGUSUYCGWPDPQD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CC#CC(O)C(Cl)(Cl)Cl |
|
~%
1,1,1-trichloro... CAS#:57212-21-2 |
| Literature: Deleris; Dunogues; Babin; et al. European Journal of Medicinal Chemistry, 1981 , vol. 16, # 6 p. 533 - 537 |
|
~%
1,1,1-trichloro... CAS#:57212-21-2 |
| Literature: Deleris,G. et al. Journal of Organometallic Chemistry, 1975 , vol. 93, p. 43 - 50 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |