2-chloro-1-(2,3,4,5,6-pentamethylphenyl)ethanone
Modify Date: 2024-02-02 15:09:59
2-chloro-1-(2,3,4,5,6-pentamethylphenyl)ethanone structure
|
Common Name | 2-chloro-1-(2,3,4,5,6-pentamethylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 57196-63-1 | Molecular Weight | 224.72600 | |
| Density | 1.051g/cm3 | Boiling Point | 350.4ºC at 760 mmHg | |
| Molecular Formula | C13H17ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.8ºC | |
| Name | 2-chloro-1-(2,3,4,5,6-pentamethylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.051g/cm3 |
|---|---|
| Boiling Point | 350.4ºC at 760 mmHg |
| Molecular Formula | C13H17ClO |
| Molecular Weight | 224.72600 |
| Flash Point | 198.8ºC |
| Exact Mass | 224.09700 |
| PSA | 17.07000 |
| LogP | 3.65010 |
| Index of Refraction | 1.522 |
| InChIKey | SPPLVERXFNZFAP-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(C)c(C(=O)CCl)c(C)c1C |
| HS Code | 2914700090 |
|---|
|
~%
2-chloro-1-(2,3... CAS#:57196-63-1 |
| Literature: Kunckell Chemische Berichte, 1897 , vol. 30, p. 1713 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Chloro-1-(2,3,4,5,6-pentamethylphenyl)ethan-1-one |
| Chlormethyl-pentamethylphenyl-keton |
| 2-Chlor-1-pentamethylphenyl-aethanon |
| 2-chloro-1-(pentamethylphenyl)ethanone |
| 2-Chlor-2',3',4',5',6'-pentamethylacetophenon |