(Z)-N-(3-carboxy-1-oxoallyl)-DL-methionine structure
|
Common Name | (Z)-N-(3-carboxy-1-oxoallyl)-DL-methionine | ||
|---|---|---|---|---|
| CAS Number | 57079-19-3 | Molecular Weight | 247.26800 | |
| Density | 1.371g/cm3 | Boiling Point | 586.8ºC at 760mmHg | |
| Molecular Formula | C9H13NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.7ºC | |
| Name | (Z)-N-(3-carboxy-1-oxoallyl)-DL-methionine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 586.8ºC at 760mmHg |
| Molecular Formula | C9H13NO5S |
| Molecular Weight | 247.26800 |
| Flash Point | 308.7ºC |
| Exact Mass | 247.05100 |
| PSA | 129.00000 |
| LogP | 0.34060 |
| Index of Refraction | 1.562 |
| InChIKey | FJZYCKGQUGEQLO-IHWYPQMZSA-N |
| SMILES | CSCCC(NC(=O)C=CC(=O)O)C(=O)O |
|
~%
(Z)-N-(3-carbox... CAS#:57079-19-3 |
| Literature: Barakat et al. Journal of the Chemical Society, 1957 , p. 4133 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(3c-carboxy-acryloyl)-methionine |
| Einecs 260-554-6 |
| N-[(Z)-3-Carboxy-1-oxo-2-propenyl]-DL-methionine |