2-Propen-1-one,1-(4-chlorophenyl)-3-(2,4-dichlorophenyl)- structure
|
Common Name | 2-Propen-1-one,1-(4-chlorophenyl)-3-(2,4-dichlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 57076-84-3 | Molecular Weight | 311.59000 | |
| Density | 1.38g/cm3 | Boiling Point | 448.5ºC at 760mmHg | |
| Molecular Formula | C15H9Cl3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189ºC | |
| Name | (E)-1-(4-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-en-1-one |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 448.5ºC at 760mmHg |
| Molecular Formula | C15H9Cl3O |
| Molecular Weight | 311.59000 |
| Flash Point | 189ºC |
| Exact Mass | 309.97200 |
| PSA | 17.07000 |
| LogP | 5.54290 |
| Index of Refraction | 1.644 |
| InChIKey | GSQGUMFXFLWUJU-XBXARRHUSA-N |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
|
~94%
2-Propen-1-one,... CAS#:57076-84-3 |
| Literature: Rezaie, Ramin; Heidary, Mohammad; Soltani Rad, Mohammad Navid; Behrouz, Somayeh Chinese Journal of Chemistry, 2011 , vol. 29, # 6 p. 1221 - 1226 |
|
~%
2-Propen-1-one,... CAS#:57076-84-3 |
| Literature: Karthikeyan, Mari S.; Holla, Bantwal S.; Shenoy, Shalini Monatshefte fur Chemie, 2008 , vol. 139, # 6 p. 707 - 716 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |