3-(3-bromophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one structure
|
Common Name | 3-(3-bromophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 57073-26-4 | Molecular Weight | 317.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-bromophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13BrO2 |
|---|---|
| Molecular Weight | 317.17700 |
| Exact Mass | 316.01000 |
| PSA | 26.30000 |
| LogP | 4.35380 |
| InChIKey | RSWWQJNMOSIIDP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2cccc(Br)c2)cc1 |
|
~76%
3-(3-bromopheny... CAS#:57073-26-4 |
| Literature: Popat; Nimavat; Kachhadia; Joshi Journal of the Indian Chemical Society, 2003 , vol. 80, # 7 p. 707 - 708 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Bromo-4'-methoxychalcone |