Nifenalol structure
|
Common Name | Nifenalol | ||
|---|---|---|---|---|
| CAS Number | 5704-60-9 | Molecular Weight | 260.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NifenalolNifenalol hydrochloride is a β-adrenergic receptor antagonist. Nifenalol hydrochloride induces the Early Afterdepolarization (EAD) effect. EAD is a phenomenon in cardiac electrophysiology that usually occurs during an action potential in ventricular muscle cells and can lead to arrhythmia. The EAD effect of Nifenalol hydrochloride can be blocked by Tetrodotoxin. Nifenalol hydrochloride is used in the study of conditions such as irregular heartbeat or high blood pressure[1]. |
| Name | Nifenalol hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Nifenalol hydrochloride is a β-adrenergic receptor antagonist. Nifenalol hydrochloride induces the Early Afterdepolarization (EAD) effect. EAD is a phenomenon in cardiac electrophysiology that usually occurs during an action potential in ventricular muscle cells and can lead to arrhythmia. The EAD effect of Nifenalol hydrochloride can be blocked by Tetrodotoxin. Nifenalol hydrochloride is used in the study of conditions such as irregular heartbeat or high blood pressure[1]. |
|---|---|
| Related Catalog | |
| Target |
β-adrenoceptor |
| References |
| Molecular Formula | C11H17ClN2O3 |
|---|---|
| Molecular Weight | 260.72 |
| Exact Mass | 260.09300 |
| PSA | 78.08000 |
| LogP | 3.34230 |
| InChIKey | STGOXRVTUNXXLQ-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)c1ccc([N+](=O)[O-])cc1.Cl |
| HS Code | 2922199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| INPEA hydrochloride |
| N-isopropyl-p-nitrophenylethanolamine hydrochloride |
| Nifenalol |