1-phenylethyl (E)-3-phenylprop-2-enoate structure
|
Common Name | 1-phenylethyl (E)-3-phenylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 56961-72-9 | Molecular Weight | 252.30800 | |
| Density | 1.104g/cm3 | Boiling Point | 373.5ºC at 760 mmHg | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.7ºC | |
| Name | 1-phenylethyl (E)-3-phenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.104g/cm3 |
|---|---|
| Boiling Point | 373.5ºC at 760 mmHg |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.30800 |
| Flash Point | 218.7ºC |
| Exact Mass | 252.11500 |
| PSA | 26.30000 |
| LogP | 4.00420 |
| Index of Refraction | 1.595 |
| InChIKey | CVEWELHXJQWZIR-OUKQBFOZSA-N |
| SMILES | CC(OC(=O)C=Cc1ccccc1)c1ccccc1 |
|
~73%
1-phenylethyl (... CAS#:56961-72-9 |
| Literature: Magens, Silja; Plietker, Bernd Journal of Organic Chemistry, 2010 , vol. 75, # 11 p. 3715 - 3721 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| cinnamic acid 1-phenylethyl ester |