1,2-bis(4-chlorophenyl)ethanol structure
|
Common Name | 1,2-bis(4-chlorophenyl)ethanol | ||
|---|---|---|---|---|
| CAS Number | 56960-97-5 | Molecular Weight | 267.15000 | |
| Density | 1.302g/cm3 | Boiling Point | 371ºC at 760 mmHg | |
| Molecular Formula | C14H12Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.8ºC | |
| Name | 1,2-bis(4-chlorophenyl)ethanol |
|---|
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 371ºC at 760 mmHg |
| Molecular Formula | C14H12Cl2O |
| Molecular Weight | 267.15000 |
| Flash Point | 141.8ºC |
| Exact Mass | 266.02700 |
| PSA | 20.23000 |
| LogP | 4.26950 |
| Index of Refraction | 1.615 |
| InChIKey | RGMCATMRVFCULW-UHFFFAOYSA-N |
| SMILES | OC(Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| HS Code | 2906299090 |
|---|
|
~%
1,2-bis(4-chlor... CAS#:56960-97-5 |
| Literature: Lutz; Murphey Journal of the American Chemical Society, 1949 , vol. 71, p. 478,480 |
|
~24%
1,2-bis(4-chlor... CAS#:56960-97-5 |
| Literature: Scholz, Michael; Ulbrich, Holger K.; Dannhardt, Gerd European Journal of Medicinal Chemistry, 2008 , vol. 43, # 6 p. 1152 - 1159 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |