3-Pyridinecarboxylicacid, 1,2-dihydro-6-hydroxy-4-methyl-2-oxo-, ethyl ester structure
|
Common Name | 3-Pyridinecarboxylicacid, 1,2-dihydro-6-hydroxy-4-methyl-2-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 56951-00-9 | Molecular Weight | 197.18800 | |
| Density | 1.292g/cm3 | Boiling Point | 307.3ºC at 760mmHg | |
| Molecular Formula | C9H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.7ºC | |
| Name | 3-[ethoxy(hydroxy)methylidene]-4-methylpyridine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 307.3ºC at 760mmHg |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.18800 |
| Flash Point | 139.7ºC |
| Exact Mass | 197.06900 |
| PSA | 79.39000 |
| LogP | 0.56560 |
| Index of Refraction | 1.538 |
| InChIKey | WYOOCSFQISHBAA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)cc(=O)[nH]c1O |
| HS Code | 2933399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridinecarboxylate |