1-N-Cbz-Nipecotamide structure
|
Common Name | 1-N-Cbz-Nipecotamide | ||
|---|---|---|---|---|
| CAS Number | 569348-14-7 | Molecular Weight | 262.30400 | |
| Density | 1.224 g/cm3 | Boiling Point | 475.5ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Cbz-3-carbamoylpiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224 g/cm3 |
|---|---|
| Boiling Point | 475.5ºC at 760 mmHg |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.30400 |
| Exact Mass | 262.13200 |
| PSA | 72.63000 |
| LogP | 2.15870 |
| Index of Refraction | 1.568 |
| InChIKey | JVNTYSRHYYSZEM-UHFFFAOYSA-N |
| SMILES | NC(=O)C1CCCN(C(=O)OCc2ccccc2)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| benzyl 3-carbamoylpiperidine-1-carboxylate |