2-(2-hydroxy-2,2-diphenylacetyl)oxyethyl-dimethyl-pentylazanium,bromide structure
|
Common Name | 2-(2-hydroxy-2,2-diphenylacetyl)oxyethyl-dimethyl-pentylazanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 56927-39-0 | Molecular Weight | 450.40900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H32BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-hydroxy-2,2-diphenylacetyl)oxyethyl-dimethyl-pentylazanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H32BrNO3 |
|---|---|
| Molecular Weight | 450.40900 |
| Exact Mass | 449.15700 |
| PSA | 46.53000 |
| LogP | 0.73630 |
| InChIKey | FOPWIKCTANOJML-UHFFFAOYSA-M |
| SMILES | CCCCC[N+](C)(C)CCOC(=O)C(O)(c1ccccc1)c1ccccc1.[Br-] |
| HS Code | 2923900090 |
|---|
|
~%
2-(2-hydroxy-2,... CAS#:56927-39-0 |
| Literature: Ford-Moore; Ing Journal of the Chemical Society, 1947 , p. 59 |
|
~%
2-(2-hydroxy-2,... CAS#:56927-39-0 |
| Literature: Ford-Moore; Ing Journal of the Chemical Society, 1947 , p. 59 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzilsaeure-dimethyl-pentyl-ammonium-aethylester bromide |