6-methoxy-2-naphthalenesulfonyl chloride(SALTDATA: FREE)
Modify Date: 2025-10-01 16:12:00
6-methoxy-2-naphthalenesulfonyl chloride(SALTDATA: FREE) structure
|
Common Name | 6-methoxy-2-naphthalenesulfonyl chloride(SALTDATA: FREE) | ||
|---|---|---|---|---|
| CAS Number | 56875-59-3 | Molecular Weight | 256.70500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9ClO3S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 6-methoxynaphthalene-2-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9ClO3S |
|---|---|
| Molecular Weight | 256.70500 |
| Exact Mass | 255.99600 |
| PSA | 51.75000 |
| LogP | 3.85670 |
| InChIKey | QYCDJXYAIDWYFK-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(S(=O)(=O)Cl)ccc2c1 |
| HS Code | 2909309090 |
|---|
|
~72%
6-methoxy-2-nap... CAS#:56875-59-3 |
| Literature: GRUeNENTHAL GMBH; MERLA, Beatrix; OBERBOeRSCH, Stefan; REICH, Melanie; SCHUNK, Stefan; JOSTOCK, Ruth; HEES, Sabine; ENGELS, Michael; GERMANN, Tieno; BIJSTERVELD, Edward Patent: WO2010/99938 A1, 2010 ; Location in patent: Page/Page column 72 ; |
|
~%
6-methoxy-2-nap... CAS#:56875-59-3 |
| Literature: Loewenthal, H. J. E.; Gottlieb, L. Journal of Organic Chemistry, 1992 , vol. 57, # 9 p. 2631 - 2641 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:139633-72-0| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 6-methoxynaphthalenesulfonyl chloride |
| 6-methoxy-2-naphthalenesulfonyl chloride |
| 2-Naphthalenesulfonyl chloride,6-methoxy |
| 6-Methoxy-naphthalin-2-sulfonylchlorid |
| 6-methoxy-naphthalene-2-sulfonyl chloride |
| 6-methoxy-2-naphthylsulphonyl chloride |