3,5-dibromo-3,5-dimethylheptan-4-one structure
|
Common Name | 3,5-dibromo-3,5-dimethylheptan-4-one | ||
|---|---|---|---|---|
| CAS Number | 56829-64-2 | Molecular Weight | 300.03100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dibromo-3,5-dimethylheptan-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H16Br2O |
|---|---|
| Molecular Weight | 300.03100 |
| Exact Mass | 297.95700 |
| PSA | 17.07000 |
| LogP | 3.68270 |
| InChIKey | RRUYKQDYYLBQTH-UHFFFAOYSA-N |
| SMILES | CCC(C)(Br)C(=O)C(C)(Br)CC |
| HS Code | 2914700090 |
|---|
|
~94%
3,5-dibromo-3,5... CAS#:56829-64-2 |
| Literature: Quast, Helmut; Jakobi, Harald; Seiferling, Bernhard Liebigs Annalen der Chemie, 1991 , p. 41 - 46 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Heptanone,3,5-dibromo-3,5-dimethyl |
| 3,5-dibromo-3,5-dimethyl-heptan-4-one |
| 3,5-DIBROMO-3,5-DIMETHYL-4-HEPTANONE |