6-(4-chlorophenyl)-6-oxohexanoic acid
Modify Date: 2025-09-18 01:36:11
6-(4-chlorophenyl)-6-oxohexanoic acid structure
|
Common Name | 6-(4-chlorophenyl)-6-oxohexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 56721-40-5 | Molecular Weight | 240.68300 | |
| Density | 1.243g/cm3 | Boiling Point | 429.981ºC at 760 mmHg | |
| Molecular Formula | C12H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.845ºC | |
| Name | 6-(4-chlorophenyl)-6-oxohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 429.981ºC at 760 mmHg |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.68300 |
| Flash Point | 213.845ºC |
| Exact Mass | 240.05500 |
| PSA | 54.37000 |
| LogP | 3.16770 |
| Index of Refraction | 1.546 |
| InChIKey | WTAIFOPOCXTVCX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCC(=O)c1ccc(Cl)cc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-(4-Chlor-benzoyl)-valeriansaeure |
| 6-(4-Chlor-phenyl)-6-oxo-hexansaeure |
| 5-(p-chloro-benzoyl)valeric acid |
| 6-(4-chloro-phenyl)-6-oxo-hexanoic acid |
| 5-(4-Chlorobenzoyl)pentanoic acid |