N,1-dicyclohexyl-2,4,6-trioxo-5,5-bis(prop-2-enyl)piperidine-3-carboxamide structure
|
Common Name | N,1-dicyclohexyl-2,4,6-trioxo-5,5-bis(prop-2-enyl)piperidine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 56714-20-6 | Molecular Weight | 414.53800 | |
| Density | 1.15g/cm3 | Boiling Point | 618.3ºC at 760 mmHg | |
| Molecular Formula | C24H34N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.7ºC | |
| Name | N,1-dicyclohexyl-2,4,6-trioxo-5,5-bis(prop-2-enyl)piperidine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 618.3ºC at 760 mmHg |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.53800 |
| Flash Point | 327.7ºC |
| Exact Mass | 414.25200 |
| PSA | 87.04000 |
| LogP | 4.23890 |
| Index of Refraction | 1.548 |
| InChIKey | CSLJSIKAKZICMD-UHFFFAOYSA-N |
| SMILES | C=CCC1(CC=C)C(=O)C(C(=O)NC2CCCCC2)C(=O)N(C2CCCCC2)C1=O |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| NIPECOTAMIDE,5,5-DIALLYL-N,1-DICYCLOHEXYL-2,4,6-TRIOXO |
| 5,5-diallyl-1-cyclohexyl-2,4,6-trioxo-piperidine-3-carboxylic acid cyclohexylamide |
| 5,5-Diallyl-N,1-dicyclohexyl-2,4,6-trioxonipecotamide |
| 1-Cyclohexyl-3,3-diallyl-2,4,6-triketopiperidin-5N-cyclohexylcarboxamid |
| 1-Cyclohexyl-3,3-diallyl-2,4,6-triketopiperidine-5-N-cyclohexylcarboxamide |