1,3,3a,4,9,9a-hexahydrothieno[3,4-b]quinoxaline 2,2-dioxide structure
|
Common Name | 1,3,3a,4,9,9a-hexahydrothieno[3,4-b]quinoxaline 2,2-dioxide | ||
|---|---|---|---|---|
| CAS Number | 56714-11-5 | Molecular Weight | 224.27900 | |
| Density | 1.326g/cm3 | Boiling Point | 523.6ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.5ºC | |
| Name | 1,3,3a,4,9,9a-hexahydrothieno[3,4-b]quinoxaline 2,2-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 523.6ºC at 760 mmHg |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.27900 |
| Flash Point | 270.5ºC |
| Exact Mass | 224.06200 |
| PSA | 66.58000 |
| LogP | 2.04640 |
| Index of Refraction | 1.592 |
| InChIKey | NWKHHQLOAXTGLM-UHFFFAOYSA-N |
| SMILES | O=S1(=O)CC2Nc3ccccc3NC2C1 |
| HS Code | 2933990090 |
|---|
|
~75%
1,3,3a,4,9,9a-h... CAS#:56714-11-5 |
| Literature: Chou, Ta-shue; Ko, Chung-Wen Tetrahedron, 1994 , vol. 50, # 36 p. 10721 - 10726 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-dihydrothieno<3,4-b>-1,2,3,4-tetrahydroquinoxaline 2,2-dioxide |