5-oxo-L-proline, compound with (9S)-cinchonan-9-ol (1:1)
Modify Date: 2025-09-21 16:32:42
5-oxo-L-proline, compound with (9S)-cinchonan-9-ol (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with (9S)-cinchonan-9-ol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 56652-33-6 | Molecular Weight | 423.50500 | |
| Density | N/A | Boiling Point | 464.5ºC at 760 mmHg | |
| Molecular Formula | C24H29N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.7ºC | |
| Name | (S)-[(4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol,(2S)-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 464.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.50500 |
| Flash Point | 234.7ºC |
| Exact Mass | 423.21600 |
| PSA | 106.25000 |
| LogP | 2.72800 |
| InChIKey | IOFJVJGKFAPBNG-GVDYMPHKSA-N |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2ccccc12.O=C1CCC(C(=O)O)N1 |
| einecs 260-313-5 |