3-(6-methoxynaphthalen-2-yl)pentan-2-one
Modify Date: 2025-09-30 21:32:11
3-(6-methoxynaphthalen-2-yl)pentan-2-one structure
|
Common Name | 3-(6-methoxynaphthalen-2-yl)pentan-2-one | ||
|---|---|---|---|---|
| CAS Number | 56600-75-0 | Molecular Weight | 242.31300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(6-methoxynaphthalen-2-yl)pentan-2-one |
|---|
| Molecular Formula | C16H18O2 |
|---|---|
| Molecular Weight | 242.31300 |
| Exact Mass | 242.13100 |
| PSA | 26.30000 |
| LogP | 3.93100 |
| InChIKey | MKHWWYBECYQCDY-UHFFFAOYSA-N |
| SMILES | CCC(C(C)=O)c1ccc2cc(OC)ccc2c1 |
|
~%
3-(6-methoxynap... CAS#:56600-75-0 |
| Literature: Johnson et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 4995,4998 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |