Benzoic acid,4-[[2,2,3,3,4,4,4-heptafluoro-1-(1-nitroethyl)butyl]amino]- structure
|
Common Name | Benzoic acid,4-[[2,2,3,3,4,4,4-heptafluoro-1-(1-nitroethyl)butyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 564-96-5 | Molecular Weight | 392.22600 | |
| Density | 1.533g/cm3 | Boiling Point | 427.1ºC at 760 mmHg | |
| Molecular Formula | C13H11F7N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.1ºC | |
| Name | 4-[(4,4,5,5,6,6,6-heptafluoro-2-nitrohexan-3-yl)amino]benzoic acid |
|---|
| Density | 1.533g/cm3 |
|---|---|
| Boiling Point | 427.1ºC at 760 mmHg |
| Molecular Formula | C13H11F7N2O4 |
| Molecular Weight | 392.22600 |
| Flash Point | 212.1ºC |
| Exact Mass | 392.06100 |
| PSA | 95.15000 |
| LogP | 4.25960 |
| Index of Refraction | 1.482 |
| InChIKey | TWWSDKQJXNOUNK-UHFFFAOYSA-N |
| SMILES | CC(C(Nc1ccc(C(=O)O)cc1)C(F)(F)C(F)(F)C(F)(F)F)[N+](=O)[O-] |
|
~%
Benzoic acid,4-... CAS#:564-96-5 |
| Literature: Cook et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 83,85 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |