N-(5,8-dimethoxyquinoxalin-6-yl)-N',N'-dimethylethane-1,2-diamine structure
|
Common Name | N-(5,8-dimethoxyquinoxalin-6-yl)-N',N'-dimethylethane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 56393-39-6 | Molecular Weight | 276.33400 | |
| Density | 1.179g/cm3 | Boiling Point | 439.6ºC at 760 mmHg | |
| Molecular Formula | C14H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.7ºC | |
| Name | N-(5,8-dimethoxyquinoxalin-6-yl)-N',N'-dimethylethane-1,2-diamine |
|---|
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 439.6ºC at 760 mmHg |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.33400 |
| Flash Point | 219.7ºC |
| Exact Mass | 276.15900 |
| PSA | 59.51000 |
| LogP | 1.69350 |
| Index of Refraction | 1.606 |
| InChIKey | DXYVQOIASCBRBZ-UHFFFAOYSA-N |
| SMILES | COc1cc(NCCN(C)C)c(OC)c2nccnc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |