r-(phenylmethyl)- structure
|
Common Name | r-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 5638-33-5 | Molecular Weight | 232.31800 | |
| Density | 1.086g/cm3 | Boiling Point | 373.4ºC at 760 mmHg | |
| Molecular Formula | C15H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.3ºC | |
| Name | 2-cyclohexyl-3-phenyl-propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.086g/cm3 |
|---|---|
| Boiling Point | 373.4ºC at 760 mmHg |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.31800 |
| Flash Point | 270.3ºC |
| Exact Mass | 232.14600 |
| PSA | 37.30000 |
| LogP | 3.51020 |
| Index of Refraction | 1.544 |
| InChIKey | JRILKALTDODAHU-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cc1ccccc1)C1CCCCC1 |
|
~%
r-(phenylmethyl)- CAS#:5638-33-5 |
| Literature: Moffett; Hart; Hoehn Journal of the American Chemical Society, 1947 , vol. 69, p. 1854,1855 |
|
~%
r-(phenylmethyl)- CAS#:5638-33-5 |
| Literature: Moffett; Hart; Hoehn Journal of the American Chemical Society, 1947 , vol. 69, p. 1854,1855 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Cyclohexyl-3-phenyl-oxaziridin |
| 2-Cyclohexyl-3-phenyl-oxaziridine |
| 2-Cyclohexyl-3-phenyl-propionsaeure |
| (E)-2-cyclohexyl-3-phenyloxaziridine |