1-[2,2-dichloro-1-(4-methoxyphenyl)propyl]-4-methoxybenzene
Modify Date: 2025-11-27 17:06:48
![1-[2,2-dichloro-1-(4-methoxyphenyl)propyl]-4-methoxybenzene Structure](https://image.chemsrc.com/caspic/304/56288-27-8.png)
1-[2,2-dichloro-1-(4-methoxyphenyl)propyl]-4-methoxybenzene structure
|
Common Name | 1-[2,2-dichloro-1-(4-methoxyphenyl)propyl]-4-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 56288-27-8 | Molecular Weight | 325.23000 | |
| Density | 1.189g/cm3 | Boiling Point | 432.7ºC at 760 mmHg | |
| Molecular Formula | C17H18Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.8ºC | |
| Name | 1-[2,2-dichloro-1-(4-methoxyphenyl)propyl]-4-methoxybenzene |
|---|
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 432.7ºC at 760 mmHg |
| Molecular Formula | C17H18Cl2O2 |
| Molecular Weight | 325.23000 |
| Flash Point | 146.8ºC |
| Exact Mass | 324.06800 |
| PSA | 18.46000 |
| LogP | 5.02950 |
| Index of Refraction | 1.555 |
| InChIKey | TWGGRWPPMMOFFI-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)C(C)(Cl)Cl)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |