1-ethoxy-4-[2-methyl-1-(4-methylphenyl)propyl]benzene
Modify Date: 2025-09-20 06:40:02
![1-ethoxy-4-[2-methyl-1-(4-methylphenyl)propyl]benzene Structure](https://image.chemsrc.com/caspic/020/56265-26-0.png)
1-ethoxy-4-[2-methyl-1-(4-methylphenyl)propyl]benzene structure
|
Common Name | 1-ethoxy-4-[2-methyl-1-(4-methylphenyl)propyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 56265-26-0 | Molecular Weight | 268.39300 | |
| Density | 0.971g/cm3 | Boiling Point | 371ºC at 760 mmHg | |
| Molecular Formula | C19H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.7ºC | |
| Name | 1-ethoxy-4-[2-methyl-1-(4-methylphenyl)propyl]benzene |
|---|
| Density | 0.971g/cm3 |
|---|---|
| Boiling Point | 371ºC at 760 mmHg |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.39300 |
| Flash Point | 148.7ºC |
| Exact Mass | 268.18300 |
| PSA | 9.23000 |
| LogP | 5.18160 |
| Index of Refraction | 1.531 |
| InChIKey | ZZRKZECQKCVLKU-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(c2ccc(C)cc2)C(C)C)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |