1-[2-chloro-1-(4-ethoxyphenyl)-2-methylpropyl]-4-ethoxybenzene structure
|
Common Name | 1-[2-chloro-1-(4-ethoxyphenyl)-2-methylpropyl]-4-ethoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 56265-24-8 | Molecular Weight | 332.86400 | |
| Density | 1.068g/cm3 | Boiling Point | 442.3ºC at 760 mmHg | |
| Molecular Formula | C20H25ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.1ºC | |
| Name | 1-[2-chloro-1-(4-ethoxyphenyl)-2-methylpropyl]-4-ethoxybenzene |
|---|
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 442.3ºC at 760 mmHg |
| Molecular Formula | C20H25ClO2 |
| Molecular Weight | 332.86400 |
| Flash Point | 132.1ºC |
| Exact Mass | 332.15400 |
| PSA | 18.46000 |
| LogP | 5.63330 |
| Index of Refraction | 1.534 |
| InChIKey | DIJUBVIDRZKMKE-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(c2ccc(OCC)cc2)C(C)(C)Cl)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |