2'-Methyl-3'-nitroacetanilide structure
|
Common Name | 2'-Methyl-3'-nitroacetanilide | ||
|---|---|---|---|---|
| CAS Number | 56207-36-4 | Molecular Weight | 194.18700 | |
| Density | 1.289 g/cm3 | Boiling Point | 353.4ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O3 | Melting Point | 162ºC | |
| MSDS | N/A | Flash Point | 167.6ºC | |
| Name | 2'-Methyl-3'-nitroacetanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289 g/cm3 |
|---|---|
| Boiling Point | 353.4ºC at 760 mmHg |
| Melting Point | 162ºC |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.18700 |
| Flash Point | 167.6ºC |
| Exact Mass | 194.06900 |
| PSA | 74.92000 |
| LogP | 2.45780 |
| Index of Refraction | 1.605 |
| InChIKey | NMYFXIITWKKOKY-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc([N+](=O)[O-])c1C |
| HS Code | 2924299090 |
|---|
|
~%
2'-Methyl-3'-ni... CAS#:56207-36-4 |
| Literature: US2002/161031 A1, ; |
|
~%
2'-Methyl-3'-ni... CAS#:56207-36-4 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 172, p. 224,228 |
|
~%
2'-Methyl-3'-ni... CAS#:56207-36-4 |
| Literature: Journal of the Chemical Society, , vol. 117, p. 878 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(2-methyl-3-nitrophenyl)acetamide |