ethyl 2-(3,4-dichlorophenyl)-2,2-difluoroacetate structure
|
Common Name | ethyl 2-(3,4-dichlorophenyl)-2,2-difluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 56177-76-5 | Molecular Weight | 269.07200 | |
| Density | 1.384g/cm3 | Boiling Point | 290.1ºC at 760mmHg | |
| Molecular Formula | C10H8Cl2F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.7ºC | |
| Name | ethyl 2-(3,4-dichlorophenyl)-2,2-difluoroacetate |
|---|
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 290.1ºC at 760mmHg |
| Molecular Formula | C10H8Cl2F2O2 |
| Molecular Weight | 269.07200 |
| Flash Point | 110.7ºC |
| Exact Mass | 267.98700 |
| PSA | 26.30000 |
| LogP | 3.64830 |
| Index of Refraction | 1.493 |
| InChIKey | GEGREBJUAOJJTH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(F)(F)c1ccc(Cl)c(Cl)c1 |
| Storage condition | 2-8℃ |
| HS Code | 2916399090 |
|---|
|
~70%
ethyl 2-(3,4-di... CAS#:56177-76-5 |
| Literature: Fujikawa, Kenichi; Fujioka, Yasutaka; Kobayashi, Akira; Amii, Hideki Organic Letters, 2011 , vol. 13, # 20 p. 5560 - 5563 |
|
~42%
ethyl 2-(3,4-di... CAS#:56177-76-5 |
| Literature: Fujikawa, Kenichi; Fujioka, Yasutaka; Kobayashi, Akira; Amii, Hideki Organic Letters, 2011 , vol. 13, # 20 p. 5560 - 5563 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |